C12H12ClN7 — CID 71517520
2-chloro-9-propan-2-yl-N-pyrimidin-5-ylpurin-6-amine (PubChem CID 71517520) has the molecular formula C12H12ClN7 and a molecular weight of 289.73 g/mol. Its IUPAC name is 2-chloro-9-propan-2-yl-N-pyrimidin-5-ylpurin-6-amine.
| Compound Name | 2-chloro-9-propan-2-yl-N-pyrimidin-5-ylpurin-6-amine |
|---|---|
| PubChem CID | 71517520 |
| Molecular Formula | C12H12ClN7 |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-chloro-9-propan-2-yl-N-pyrimidin-5-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(Nc3cncnc3)nc(Cl)nc21 |
| InChI | InChI=1S/C12H12ClN7/c1-7(2)20-6-16-9-10(18-12(13)19-11(9)20)17-8-3-14-5-15-4-8/h3-7H,1-2H3,(H,17,18,19) |
| InChIKey | FWFMLCFXVACEPD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |