C16H21N7O — CID 71719167
2-methyl-2-[9-propan-2-yl-6-(pyrimidin-5-ylamino)purin-2-yl]propan-1-ol (PubChem CID 71719167) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-methyl-2-[9-propan-2-yl-6-(pyrimidin-5-ylamino)purin-2-yl]propan-1-ol.
| Compound Name | 2-methyl-2-[9-propan-2-yl-6-(pyrimidin-5-ylamino)purin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 71719167 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-methyl-2-[9-propan-2-yl-6-(pyrimidin-5-ylamino)purin-2-yl]propan-1-ol |
| SMILES | CC(C)n1cnc2c(Nc3cncnc3)nc(C(C)(C)CO)nc21 |
| InChI | InChI=1S/C16H21N7O/c1-10(2)23-9-19-12-13(20-11-5-17-8-18-6-11)21-15(22-14(12)23)16(3,4)7-24/h5-6,8-10,24H,7H2,1-4H3,(H,20,21,22) |
| InChIKey | NGDQZHZQUZQYHB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |