C17H24BrNOS — CID 71726226
(S)-N-[(R)-(2-bromophenyl)-[(1R)-cyclohex-2-en-1-yl]methyl]-2-methylpropane-2-sulfinamide (PubChem CID 71726226) has the molecular formula C17H24BrNOS and a molecular weight of 370.36 g/mol. Its IUPAC name is (S)-N-[(R)-(2-bromophenyl)-[(1R)-cyclohex-2-en-1-yl]methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(R)-(2-bromophenyl)-[(1R)-cyclohex-2-en-1-yl]methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 71726226 |
| Molecular Formula | C17H24BrNOS |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (S)-N-[(R)-(2-bromophenyl)-[(1R)-cyclohex-2-en-1-yl]methyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N[C@@H](c1ccccc1Br)[C@H]1C=CCCC1 |
| InChI | InChI=1S/C17H24BrNOS/c1-17(2,3)21(20)19-16(13-9-5-4-6-10-13)14-11-7-8-12-15(14)18/h5,7-9,11-13,16,19H,4,6,10H2,1-3H3/t13-,16+,21-/m0/s1 |
| InChIKey | GTWLAICWUDHTTA-QSZISKGPSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|