C33H44N2O3 — CID 71726571
N-[(2S,3R)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(3-prop-2-enylphenyl)butan-2-yl]hex-5-enamide (PubChem CID 71726571) has the molecular formula C33H44N2O3 and a molecular weight of 516.73 g/mol. Its IUPAC name is N-[(2S,3R)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(3-prop-2-enylphenyl)butan-2-yl]hex-5-enamide.
| Compound Name | N-[(2S,3R)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(3-prop-2-enylphenyl)butan-2-yl]hex-5-enamide |
|---|---|
| PubChem CID | 71726571 |
| Molecular Formula | C33H44N2O3 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | N-[(2S,3R)-4-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-(3-prop-2-enylphenyl)butan-2-yl]hex-5-enamide |
| SMILES | C=CCCCC(=O)N[C@@H](Cc1cccc(CC=C)c1)[C@H](O)CN[C@H]1CC2(CCC2)Oc2ccc(CC)cc21 |
| InChI | InChI=1S/C33H44N2O3/c1-4-7-8-14-32(37)35-28(21-26-13-9-12-25(19-26)11-5-2)30(36)23-34-29-22-33(17-10-18-33)38-31-16-15-24(6-3)20-27(29)31/h4-5,9,12-13,15-16,19-20,28-30,34,36H,1-2,6-8,10-11,14,17-18,21-23H2,3H3,(H,35,37)/t28-,29-,30+/m0/s1 |
| InChIKey | GFLGTJARAXRARU-OIFRRMEBSA-N |
| XLogP | 5.76 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|