C18H20O7 — CID 71730021
dimethyl (1S,2R,5R)-2-(4-methoxyphenyl)-5-methyl-7-oxo-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate (PubChem CID 71730021) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is dimethyl (1S,2R,5R)-2-(4-methoxyphenyl)-5-methyl-7-oxo-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate.
| Compound Name | dimethyl (1S,2R,5R)-2-(4-methoxyphenyl)-5-methyl-7-oxo-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 71730021 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | dimethyl (1S,2R,5R)-2-(4-methoxyphenyl)-5-methyl-7-oxo-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@]2(C)OC(=O)[C@H]2[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H20O7/c1-17-9-18(15(20)23-3,16(21)24-4)12(13(17)14(19)25-17)10-5-7-11(22-2)8-6-10/h5-8,12-13H,9H2,1-4H3/t12-,13+,17+/m0/s1 |
| InChIKey | RLXOWMXUSLDZBY-OGHNNQOOSA-N |
| XLogP | 1.45 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|