C21H19ClN4O2S — CID 71730895
3-(1,3-benzothiazol-2-yl)-7-[4-(2-chloroethyl)piperazin-1-yl]pyrano[2,3-b]pyridin-2-one (PubChem CID 71730895) has the molecular formula C21H19ClN4O2S and a molecular weight of 426.93 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-[4-(2-chloroethyl)piperazin-1-yl]pyrano[2,3-b]pyridin-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-[4-(2-chloroethyl)piperazin-1-yl]pyrano[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 71730895 |
| Molecular Formula | C21H19ClN4O2S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-[4-(2-chloroethyl)piperazin-1-yl]pyrano[2,3-b]pyridin-2-one |
| SMILES | O=c1oc2nc(N3CCN(CCCl)CC3)ccc2cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H19ClN4O2S/c22-7-8-25-9-11-26(12-10-25)18-6-5-14-13-15(21(27)28-19(14)24-18)20-23-16-3-1-2-4-17(16)29-20/h1-6,13H,7-12H2 |
| InChIKey | QKVXTKBCXDNJJF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|