C30H25O3P — CID 71734622
(Z)-3-diphenylphosphoryl-3-(1-hydroxycyclopropyl)-1,2-diphenylprop-2-en-1-one (PubChem CID 71734622) has the molecular formula C30H25O3P and a molecular weight of 464.50 g/mol. Its IUPAC name is (Z)-3-diphenylphosphoryl-3-(1-hydroxycyclopropyl)-1,2-diphenylprop-2-en-1-one.
| Compound Name | (Z)-3-diphenylphosphoryl-3-(1-hydroxycyclopropyl)-1,2-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 71734622 |
| Molecular Formula | C30H25O3P |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (Z)-3-diphenylphosphoryl-3-(1-hydroxycyclopropyl)-1,2-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(=C(/C1(O)CC1)P(=O)(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H25O3P/c31-28(24-15-7-2-8-16-24)27(23-13-5-1-6-14-23)29(30(32)21-22-30)34(33,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,32H,21-22H2/b29-27- |
| InChIKey | IURAOISLHNYQFK-OHYPFYFLSA-N |
| XLogP | 5.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|