C24H16N4O2S — CID 71739940
1-[2-(1,3-benzodioxol-5-yl)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]-N-phenylmethanimine (PubChem CID 71739940) has the molecular formula C24H16N4O2S and a molecular weight of 424.49 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]-N-phenylmethanimine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]-N-phenylmethanimine |
|---|---|
| PubChem CID | 71739940 |
| Molecular Formula | C24H16N4O2S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]-N-phenylmethanimine |
| SMILES | C(=N/c1ccccc1)\c1c(-c2ccccc2)nc2sc(-c3ccc4c(c3)OCO4)nn12 |
| InChI | InChI=1S/C24H16N4O2S/c1-3-7-16(8-4-1)22-19(14-25-18-9-5-2-6-10-18)28-24(26-22)31-23(27-28)17-11-12-20-21(13-17)30-15-29-20/h1-14H,15H2/b25-14+ |
| InChIKey | DGPUYKBCLMMZKI-AFUMVMLFSA-N |
| XLogP | 5.60 |
| TPSA | 61.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|