C20H30FeN2O2+2 — CID 71746190
CID 71746190 (PubChem CID 71746190) has the molecular formula C20H30FeN2O2+2 and a molecular weight of 386.32 g/mol.
| Compound Name | CID 71746190 |
|---|---|
| PubChem CID | 71746190 |
| Molecular Formula | C20H30FeN2O2+2 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | — |
| SMILES | C[C@@H]1N[C@H](CCNCCC[C]2[CH][CH][CH][CH]2)[C@H](O)[C@@H]1O.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C15H25N2O2.C5H5.Fe/c1-11-14(18)15(19)13(17-11)8-10-16-9-4-7-12-5-2-3-6-12;1-2-4-5-3-1;/h2-3,5-6,11,13-19H,4,7-10H2,1H3;1-5H;/q;;+2/t11-,13+,14+,15-;;/m0../s1 |
| InChIKey | BDBNLYXGWJUQNL-SNTRBBGDSA-N |
| XLogP | 1.25 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|