C23H30N2O5 — CID 7175162
[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 7175162) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 7175162 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)COC(=O)C3C[C@H]4CCC[C@@H](C3)C4=O)CC2)cc1 |
| InChI | InChI=1S/C23H30N2O5/c1-29-20-7-5-19(6-8-20)24-9-11-25(12-10-24)21(26)15-30-23(28)18-13-16-3-2-4-17(14-18)22(16)27/h5-8,16-18H,2-4,9-15H2,1H3/t16-,17+,18? |
| InChIKey | ZTGPUSCRMUSTBZ-JWTNVVGKSA-N |
| XLogP | 2.28 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|