C8H9NO2 — CID 71751620
(2R)-2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid (PubChem CID 71751620) has the molecular formula C8H9NO2 and a molecular weight of 156.20 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid.
| Compound Name | (2R)-2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid |
|---|---|
| PubChem CID | 71751620 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (2R)-2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid |
| SMILES | [2H]c1c([2H])c([2H])c([C@@H](N)C(=O)O)c([2H])c1[2H] |
| InChI | InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)/t7-/m1/s1/i1D,2D,3D,4D,5D |
| InChIKey | ZGUNAGUHMKGQNY-MWQKFOQQSA-N |
| XLogP | 0.77 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |