C16H14O4 — CID 171381899
(2S,3S)-2,3-bis(2,3,4,5,6-pentadeuteriophenyl)butanedioic acid (PubChem CID 171381899) has the molecular formula C16H14O4 and a molecular weight of 280.35 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(2,3,4,5,6-pentadeuteriophenyl)butanedioic acid.
| Compound Name | (2S,3S)-2,3-bis(2,3,4,5,6-pentadeuteriophenyl)butanedioic acid |
|---|---|
| PubChem CID | 171381899 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (2S,3S)-2,3-bis(2,3,4,5,6-pentadeuteriophenyl)butanedioic acid |
| SMILES | [2H]c1c([2H])c([2H])c([C@@H](C(=O)O)[C@H](C(=O)O)c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C16H14O4/c17-15(18)13(11-7-3-1-4-8-11)14(16(19)20)12-9-5-2-6-10-12/h1-10,13-14H,(H,17,18)(H,19,20)/t13-,14-/m1/s1/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | PVXCQHHWNDJIJP-RHNMDOTLSA-N |
| XLogP | 2.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |