C8H8N2O2 — CID 46894775
3,4,5,6-tetradeuteriobenzene-1,2-dicarboxamide (PubChem CID 46894775) has the molecular formula C8H8N2O2 and a molecular weight of 168.19 g/mol. Its IUPAC name is 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxamide.
| Compound Name | 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 46894775 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxamide |
| SMILES | [2H]c1c([2H])c([2H])c(C(N)=O)c(C(N)=O)c1[2H] |
| InChI | InChI=1S/C8H8N2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H,(H2,9,11)(H2,10,12)/i1D,2D,3D,4D |
| InChIKey | NAYYNDKKHOIIOD-RHQRLBAQSA-N |
| XLogP | -0.12 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |