C8H9NO3S — CID 169444126
2,3,4,5-tetradeuterio-6-methylsulfonylbenzamide (PubChem CID 169444126) has the molecular formula C8H9NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is 2,3,4,5-tetradeuterio-6-methylsulfonylbenzamide.
| Compound Name | 2,3,4,5-tetradeuterio-6-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 169444126 |
| Molecular Formula | C8H9NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2,3,4,5-tetradeuterio-6-methylsulfonylbenzamide |
| SMILES | [2H]c1c([2H])c([2H])c(S(C)(=O)=O)c(C(N)=O)c1[2H] |
| InChI | InChI=1S/C8H9NO3S/c1-13(11,12)7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H2,9,10)/i2D,3D,4D,5D |
| InChIKey | CJKJNTJPOYSDQL-QFFDRWTDSA-N |
| XLogP | 0.19 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |