C7H6BrNO — CID 11195051
2-bromo-3,4,5,6-tetradeuteriobenzamide (PubChem CID 11195051) has the molecular formula C7H6BrNO and a molecular weight of 204.06 g/mol. Its IUPAC name is 2-bromo-3,4,5,6-tetradeuteriobenzamide.
| Compound Name | 2-bromo-3,4,5,6-tetradeuteriobenzamide |
|---|---|
| PubChem CID | 11195051 |
| Molecular Formula | C7H6BrNO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 2-bromo-3,4,5,6-tetradeuteriobenzamide |
| SMILES | [2H]c1c([2H])c([2H])c(C(N)=O)c(Br)c1[2H] |
| InChI | InChI=1S/C7H6BrNO/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10)/i1D,2D,3D,4D |
| InChIKey | NHNAEZDWNCRWRW-RHQRLBAQSA-N |
| XLogP | 1.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |