C8H7NO3 — CID 76974611
2-carbamoyl-3,4,5,6-tetradeuteriobenzoic acid (PubChem CID 76974611) has the molecular formula C8H7NO3 and a molecular weight of 169.17 g/mol. Its IUPAC name is 2-carbamoyl-3,4,5,6-tetradeuteriobenzoic acid.
| Compound Name | 2-carbamoyl-3,4,5,6-tetradeuteriobenzoic acid |
|---|---|
| PubChem CID | 76974611 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 169.17 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-carbamoyl-3,4,5,6-tetradeuteriobenzoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)O)c(C(N)=O)c1[2H] |
| InChI | InChI=1S/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12)/i1D,2D,3D,4D |
| InChIKey | CYMRPDYINXWJFU-RHQRLBAQSA-N |
| XLogP | 0.48 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |