C16H21NS2 — CID 71752507
N,N-bis(1,1,2,2,2-pentadeuterioethyl)-4,4-dithiophen-2-ylbut-3-en-2-amine (PubChem CID 71752507) has the molecular formula C16H21NS2 and a molecular weight of 301.55 g/mol. Its IUPAC name is N,N-bis(1,1,2,2,2-pentadeuterioethyl)-4,4-dithiophen-2-ylbut-3-en-2-amine.
| Compound Name | N,N-bis(1,1,2,2,2-pentadeuterioethyl)-4,4-dithiophen-2-ylbut-3-en-2-amine |
|---|---|
| PubChem CID | 71752507 |
| Molecular Formula | C16H21NS2 |
| Molecular Weight | 301.55 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N,N-bis(1,1,2,2,2-pentadeuterioethyl)-4,4-dithiophen-2-ylbut-3-en-2-amine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C(C)C=C(c1cccs1)c1cccs1)C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H21NS2/c1-4-17(5-2)13(3)12-14(15-8-6-10-18-15)16-9-7-11-19-16/h6-13H,4-5H2,1-3H3/i1D3,2D3,4D2,5D2 |
| InChIKey | CBYWMRHUUVRIAF-IZUSZFKNSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |