C14H17NS2 — CID 131847003
4,4-dithiophen-2-yl-N,N-bis(trideuteriomethyl)but-3-en-2-amine (PubChem CID 131847003) has the molecular formula C14H17NS2 and a molecular weight of 269.47 g/mol. Its IUPAC name is 4,4-dithiophen-2-yl-N,N-bis(trideuteriomethyl)but-3-en-2-amine.
| Compound Name | 4,4-dithiophen-2-yl-N,N-bis(trideuteriomethyl)but-3-en-2-amine |
|---|---|
| PubChem CID | 131847003 |
| Molecular Formula | C14H17NS2 |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4,4-dithiophen-2-yl-N,N-bis(trideuteriomethyl)but-3-en-2-amine |
| SMILES | [2H]C([2H])([2H])N(C(C)C=C(c1cccs1)c1cccs1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C14H17NS2/c1-11(15(2)3)10-12(13-6-4-8-16-13)14-7-5-9-17-14/h4-11H,1-3H3/i2D3,3D3 |
| InChIKey | CANBGVXYBPOLRR-XERRXZQWSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |