C15H26N2O2 — CID 71760264
(7S,9Z,12R)-7-ethyl-12-propan-2-yl-1,6-diazacyclododec-9-ene-2,5-dione (PubChem CID 71760264) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is (7S,9Z,12R)-7-ethyl-12-propan-2-yl-1,6-diazacyclododec-9-ene-2,5-dione.
| Compound Name | (7S,9Z,12R)-7-ethyl-12-propan-2-yl-1,6-diazacyclododec-9-ene-2,5-dione |
|---|---|
| PubChem CID | 71760264 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (7S,9Z,12R)-7-ethyl-12-propan-2-yl-1,6-diazacyclododec-9-ene-2,5-dione |
| SMILES | CC[C@H]1C/C=C\C[C@H](C(C)C)NC(=O)CCC(=O)N1 |
| InChI | InChI=1S/C15H26N2O2/c1-4-12-7-5-6-8-13(11(2)3)17-15(19)10-9-14(18)16-12/h5-6,11-13H,4,7-10H2,1-3H3,(H,16,18)(H,17,19)/b6-5-/t12-,13+/m0/s1 |
| InChIKey | HNURNWBFEWEPFZ-AGFGORMFSA-N |
| XLogP | 2.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|