C10H16N2O2 — CID 71759653
(9E)-1,6-diazacyclododec-9-ene-2,5-dione (PubChem CID 71759653) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (9E)-1,6-diazacyclododec-9-ene-2,5-dione.
| Compound Name | (9E)-1,6-diazacyclododec-9-ene-2,5-dione |
|---|---|
| PubChem CID | 71759653 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (9E)-1,6-diazacyclododec-9-ene-2,5-dione |
| SMILES | O=C1CCC(=O)NCC/C=C/CCN1 |
| InChI | InChI=1S/C10H16N2O2/c13-9-5-6-10(14)12-8-4-2-1-3-7-11-9/h1-2H,3-8H2,(H,11,13)(H,12,14)/b2-1+ |
| InChIKey | PWDYRPNJYPIRAH-OWOJBTEDSA-N |
| XLogP | 0.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|