C21H19N5 — CID 71762193
3-[(1S)-1-[(2S)-2-(azidomethyl)pyrrolidin-1-yl]-3-phenylprop-2-ynyl]benzonitrile (PubChem CID 71762193) has the molecular formula C21H19N5 and a molecular weight of 341.42 g/mol. Its IUPAC name is 3-[(1S)-1-[(2S)-2-(azidomethyl)pyrrolidin-1-yl]-3-phenylprop-2-ynyl]benzonitrile.
| Compound Name | 3-[(1S)-1-[(2S)-2-(azidomethyl)pyrrolidin-1-yl]-3-phenylprop-2-ynyl]benzonitrile |
|---|---|
| PubChem CID | 71762193 |
| Molecular Formula | C21H19N5 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[(1S)-1-[(2S)-2-(azidomethyl)pyrrolidin-1-yl]-3-phenylprop-2-ynyl]benzonitrile |
| SMILES | N#Cc1cccc([C@@H](C#Cc2ccccc2)N2CCC[C@H]2CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C21H19N5/c22-15-18-8-4-9-19(14-18)21(12-11-17-6-2-1-3-7-17)26-13-5-10-20(26)16-24-25-23/h1-4,6-9,14,20-21H,5,10,13,16H2/t20-,21+/m0/s1 |
| InChIKey | YPDHCIIBWJIHFU-LEWJYISDSA-N |
| XLogP | 4.43 |
| TPSA | 75.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|