C21H20F3NO — CID 24777092
[(2S)-1-[(1S)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidin-2-yl]methanol (PubChem CID 24777092) has the molecular formula C21H20F3NO and a molecular weight of 359.39 g/mol. Its IUPAC name is [(2S)-1-[(1S)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(1S)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 24777092 |
| Molecular Formula | C21H20F3NO |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [(2S)-1-[(1S)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1[C@H](C#Cc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F3NO/c22-21(23,24)18-11-9-17(10-12-18)20(25-14-4-7-19(25)15-26)13-8-16-5-2-1-3-6-16/h1-3,5-6,9-12,19-20,26H,4,7,14-15H2/t19-,20+/m0/s1 |
| InChIKey | UCVQPDGYRUUBDN-VQTJNVASSA-N |
| XLogP | 4.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|