C20H20ClNO — CID 25215298
[(2S)-1-[(1S)-1-(3-chlorophenyl)-3-phenylprop-2-ynyl]pyrrolidin-2-yl]methanol (PubChem CID 25215298) has the molecular formula C20H20ClNO and a molecular weight of 325.84 g/mol. Its IUPAC name is [(2S)-1-[(1S)-1-(3-chlorophenyl)-3-phenylprop-2-ynyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(1S)-1-(3-chlorophenyl)-3-phenylprop-2-ynyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 25215298 |
| Molecular Formula | C20H20ClNO |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | [(2S)-1-[(1S)-1-(3-chlorophenyl)-3-phenylprop-2-ynyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1[C@H](C#Cc1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClNO/c21-18-9-4-8-17(14-18)20(22-13-5-10-19(22)15-23)12-11-16-6-2-1-3-7-16/h1-4,6-9,14,19-20,23H,5,10,13,15H2/t19-,20+/m0/s1 |
| InChIKey | RGACTVFNUINADQ-VQTJNVASSA-N |
| XLogP | 3.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|