C24H29NO — CID 101460713
[(2S)-1-[(1S)-1-(4-tert-butylphenyl)-3-phenylprop-2-ynyl]pyrrolidin-2-yl]methanol (PubChem CID 101460713) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is [(2S)-1-[(1S)-1-(4-tert-butylphenyl)-3-phenylprop-2-ynyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(1S)-1-(4-tert-butylphenyl)-3-phenylprop-2-ynyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 101460713 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [(2S)-1-[(1S)-1-(4-tert-butylphenyl)-3-phenylprop-2-ynyl]pyrrolidin-2-yl]methanol |
| SMILES | CC(C)(C)c1ccc([C@@H](C#Cc2ccccc2)N2CCC[C@H]2CO)cc1 |
| InChI | InChI=1S/C24H29NO/c1-24(2,3)21-14-12-20(13-15-21)23(25-17-7-10-22(25)18-26)16-11-19-8-5-4-6-9-19/h4-6,8-9,12-15,22-23,26H,7,10,17-18H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | BMXSEVFJOGBCBE-XZOQPEGZSA-N |
| XLogP | 4.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|