C14H15N2O5- — CID 7176761
(E)-4-[2-[[2-(4-hydroxyphenyl)acetyl]amino]ethylamino]-4-oxobut-2-enoate (PubChem CID 7176761) has the molecular formula C14H15N2O5- and a molecular weight of 291.28 g/mol. Its IUPAC name is (E)-4-[2-[[2-(4-hydroxyphenyl)acetyl]amino]ethylamino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[2-[[2-(4-hydroxyphenyl)acetyl]amino]ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7176761 |
| Molecular Formula | C14H15N2O5- |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (E)-4-[2-[[2-(4-hydroxyphenyl)acetyl]amino]ethylamino]-4-oxobut-2-enoate |
| SMILES | O=C([O-])/C=C/C(=O)NCCNC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H16N2O5/c17-11-3-1-10(2-4-11)9-13(19)16-8-7-15-12(18)5-6-14(20)21/h1-6,17H,7-9H2,(H,15,18)(H,16,19)(H,20,21)/p-1/b6-5+ |
| InChIKey | NFWQGBLJZREYND-AATRIKPKSA-M |
| XLogP | -1.53 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|