C14H18N4O2S — CID 7179510
1-(4-methoxyphenyl)-3-[3-[(4S)-5-oxo-1,4-dihydropyrazol-4-yl]propyl]thiourea (PubChem CID 7179510) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[3-[(4S)-5-oxo-1,4-dihydropyrazol-4-yl]propyl]thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-[3-[(4S)-5-oxo-1,4-dihydropyrazol-4-yl]propyl]thiourea |
|---|---|
| PubChem CID | 7179510 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[3-[(4S)-5-oxo-1,4-dihydropyrazol-4-yl]propyl]thiourea |
| SMILES | COc1ccc(NC(=S)NCCC[C@H]2C=NNC2=O)cc1 |
| InChI | InChI=1S/C14H18N4O2S/c1-20-12-6-4-11(5-7-12)17-14(21)15-8-2-3-10-9-16-18-13(10)19/h4-7,9-10H,2-3,8H2,1H3,(H,18,19)(H2,15,17,21)/t10-/m0/s1 |
| InChIKey | SBTOTSUNFUTHFU-JTQLQIEISA-N |
| XLogP | 1.49 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|