C13H11F4N3O3S — CID 71795788
N-(6-ethoxypyrimidin-4-yl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 71795788) has the molecular formula C13H11F4N3O3S and a molecular weight of 365.31 g/mol. Its IUPAC name is N-(6-ethoxypyrimidin-4-yl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(6-ethoxypyrimidin-4-yl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71795788 |
| Molecular Formula | C13H11F4N3O3S |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-(6-ethoxypyrimidin-4-yl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCOc1cc(NS(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)ncn1 |
| InChI | InChI=1S/C13H11F4N3O3S/c1-2-23-12-6-11(18-7-19-12)20-24(21,22)8-3-4-10(14)9(5-8)13(15,16)17/h3-7H,2H2,1H3,(H,18,19,20) |
| InChIKey | XYZNMMNWLAYEFQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |