C19H20F3N3OS — CID 71797067
N-[2-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-3-phenylsulfanylpropanamide (PubChem CID 71797067) has the molecular formula C19H20F3N3OS and a molecular weight of 395.45 g/mol. Its IUPAC name is N-[2-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-3-phenylsulfanylpropanamide.
| Compound Name | N-[2-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 71797067 |
| Molecular Formula | C19H20F3N3OS |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[2-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-3-phenylsulfanylpropanamide |
| SMILES | O=C(CCSc1ccccc1)NCCc1nc(C2CC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H20F3N3OS/c20-19(21,22)16-12-15(13-6-7-13)24-17(25-16)8-10-23-18(26)9-11-27-14-4-2-1-3-5-14/h1-5,12-13H,6-11H2,(H,23,26) |
| InChIKey | KHOKZVQYRIGAFV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |