C7H16N2O4S — CID 71811338
5,8-diazaspiro[2.6]nonane;sulfuric acid (PubChem CID 71811338) has the molecular formula C7H16N2O4S and a molecular weight of 224.28 g/mol. Its IUPAC name is 5,8-diazaspiro[2.6]nonane;sulfuric acid.
| Compound Name | 5,8-diazaspiro[2.6]nonane;sulfuric acid |
|---|---|
| PubChem CID | 71811338 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 5,8-diazaspiro[2.6]nonane;sulfuric acid |
| SMILES | C1CNCC2(CC2)CN1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H14N2.H2O4S/c1-2-7(1)5-8-3-4-9-6-7;1-5(2,3)4/h8-9H,1-6H2;(H2,1,2,3,4) |
| InChIKey | VGOHBWSNBIUCGA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|