C27H25NO2S — CID 71818041
2-benzyl-4-(4-methylphenyl)sulfonyl-3-phenyl-1-prop-2-enylpyrrole (PubChem CID 71818041) has the molecular formula C27H25NO2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-benzyl-4-(4-methylphenyl)sulfonyl-3-phenyl-1-prop-2-enylpyrrole.
| Compound Name | 2-benzyl-4-(4-methylphenyl)sulfonyl-3-phenyl-1-prop-2-enylpyrrole |
|---|---|
| PubChem CID | 71818041 |
| Molecular Formula | C27H25NO2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-benzyl-4-(4-methylphenyl)sulfonyl-3-phenyl-1-prop-2-enylpyrrole |
| SMILES | C=CCn1cc(S(=O)(=O)c2ccc(C)cc2)c(-c2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C27H25NO2S/c1-3-18-28-20-26(31(29,30)24-16-14-21(2)15-17-24)27(23-12-8-5-9-13-23)25(28)19-22-10-6-4-7-11-22/h3-17,20H,1,18-19H2,2H3 |
| InChIKey | UNYLLEZYAUOCSJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|