C22H22IN3 — CID 71818676
N,1-dimethyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)ethenyl]quinolin-1-ium-4-amine iodide (PubChem CID 71818676) has the molecular formula C22H22IN3 and a molecular weight of 455.34 g/mol. Its IUPAC name is N,1-dimethyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)ethenyl]quinolin-1-ium-4-amine iodide.
| Compound Name | N,1-dimethyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)ethenyl]quinolin-1-ium-4-amine iodide |
|---|---|
| PubChem CID | 71818676 |
| Molecular Formula | C22H22IN3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N,1-dimethyl-2-[(E)-2-(2-methyl-1H-indol-3-yl)ethenyl]quinolin-1-ium-4-amine iodide |
| SMILES | CNc1cc(/C=C/c2c(C)[nH]c3ccccc23)[n+](C)c2ccccc12.[I-] |
| InChI | InChI=1S/C22H21N3.HI/c1-15-17(18-8-4-6-10-20(18)24-15)13-12-16-14-21(23-2)19-9-5-7-11-22(19)25(16)3;/h4-14H,1-3H3,(H,23,24);1H |
| InChIKey | AGQRAUNUQWVURP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 31.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|