C17H21ClN4O4S — CID 71823788
methyl 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-5-ethyl-1H-pyrazole-4-carboxylate (PubChem CID 71823788) has the molecular formula C17H21ClN4O4S and a molecular weight of 412.90 g/mol. Its IUPAC name is methyl 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-5-ethyl-1H-pyrazole-4-carboxylate.
| Compound Name | methyl 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-5-ethyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 71823788 |
| Molecular Formula | C17H21ClN4O4S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | methyl 3-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-5-ethyl-1H-pyrazole-4-carboxylate |
| SMILES | CCc1[nH]nc(S(=O)(=O)N2CCN(c3cccc(Cl)c3)CC2)c1C(=O)OC |
| InChI | InChI=1S/C17H21ClN4O4S/c1-3-14-15(17(23)26-2)16(20-19-14)27(24,25)22-9-7-21(8-10-22)13-6-4-5-12(18)11-13/h4-6,11H,3,7-10H2,1-2H3,(H,19,20) |
| InChIKey | CBDGBPOJBYHDRV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |