C22H29N3O2 — CID 71824590
5-(4-butoxyphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-1H-pyrazole-4-carboxamide (PubChem CID 71824590) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-butoxyphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71824590 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 5-(4-butoxyphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-1H-pyrazole-4-carboxamide |
| SMILES | CCCCOc1ccc(-c2[nH]ncc2C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-2-3-15-27-19-11-9-18(10-12-19)21-20(16-24-25-21)22(26)23-14-13-17-7-5-4-6-8-17/h7,9-12,16H,2-6,8,13-15H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | WUKOBTCLCXCDNI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|