C14H19N3O4S2 — CID 71843044
1-(2-methoxyethyl)-3-(2-propylsulfonyl-1,3-benzothiazol-6-yl)urea (PubChem CID 71843044) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(2-propylsulfonyl-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1-(2-methoxyethyl)-3-(2-propylsulfonyl-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 71843044 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(2-propylsulfonyl-1,3-benzothiazol-6-yl)urea |
| SMILES | CCCS(=O)(=O)c1nc2ccc(NC(=O)NCCOC)cc2s1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-3-8-23(19,20)14-17-11-5-4-10(9-12(11)22-14)16-13(18)15-6-7-21-2/h4-5,9H,3,6-8H2,1-2H3,(H2,15,16,18) |
| InChIKey | JPPNMFDUHOOYSY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|