C15H14N4O2S2 — CID 168544251
2-[[(2-butylsulfonyl-1,3-benzothiazol-6-yl)amino]methylidene]propanedinitrile (PubChem CID 168544251) has the molecular formula C15H14N4O2S2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 2-[[(2-butylsulfonyl-1,3-benzothiazol-6-yl)amino]methylidene]propanedinitrile.
| Compound Name | 2-[[(2-butylsulfonyl-1,3-benzothiazol-6-yl)amino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544251 |
| Molecular Formula | C15H14N4O2S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-[[(2-butylsulfonyl-1,3-benzothiazol-6-yl)amino]methylidene]propanedinitrile |
| SMILES | CCCCS(=O)(=O)c1nc2ccc(NC=C(C#N)C#N)cc2s1 |
| InChI | InChI=1S/C15H14N4O2S2/c1-2-3-6-23(20,21)15-19-13-5-4-12(7-14(13)22-15)18-10-11(8-16)9-17/h4-5,7,10,18H,2-3,6H2,1H3 |
| InChIKey | GIVZJPRDPNRQMS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|