C15H21N3O3S2 — CID 71843046
1-butan-2-yl-3-(2-propylsulfonyl-1,3-benzothiazol-6-yl)urea (PubChem CID 71843046) has the molecular formula C15H21N3O3S2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 1-butan-2-yl-3-(2-propylsulfonyl-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1-butan-2-yl-3-(2-propylsulfonyl-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 71843046 |
| Molecular Formula | C15H21N3O3S2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1-butan-2-yl-3-(2-propylsulfonyl-1,3-benzothiazol-6-yl)urea |
| SMILES | CCCS(=O)(=O)c1nc2ccc(NC(=O)NC(C)CC)cc2s1 |
| InChI | InChI=1S/C15H21N3O3S2/c1-4-8-23(20,21)15-18-12-7-6-11(9-13(12)22-15)17-14(19)16-10(3)5-2/h6-7,9-10H,4-5,8H2,1-3H3,(H2,16,17,19) |
| InChIKey | QQFFTIFXGNXTSI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |