C23H18N2O2S2 — CID 71843434
N-(5-cyclopropyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 71843434) has the molecular formula C23H18N2O2S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-(5-cyclopropyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-(5-cyclopropyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 71843434 |
| Molecular Formula | C23H18N2O2S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-(5-cyclopropyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)Nc1ccc2c(c1)Sc1ccccc1C(=O)N2C1CC1 |
| InChI | InChI=1S/C23H18N2O2S2/c26-22(12-10-17-4-3-13-28-17)24-15-7-11-19-21(14-15)29-20-6-2-1-5-18(20)23(27)25(19)16-8-9-16/h1-7,10-14,16H,8-9H2,(H,24,26) |
| InChIKey | UECXCOFJTRMKBE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|