C19H24ClN3O3 — CID 71844743
ethyl 2-[[2-(4-chlorophenyl)-6-methylpyrimidin-4-yl]methyl-(2-methoxyethyl)amino]acetate (PubChem CID 71844743) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is ethyl 2-[[2-(4-chlorophenyl)-6-methylpyrimidin-4-yl]methyl-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[[2-(4-chlorophenyl)-6-methylpyrimidin-4-yl]methyl-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 71844743 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | ethyl 2-[[2-(4-chlorophenyl)-6-methylpyrimidin-4-yl]methyl-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)Cc1cc(C)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-4-26-18(24)13-23(9-10-25-3)12-17-11-14(2)21-19(22-17)15-5-7-16(20)8-6-15/h5-8,11H,4,9-10,12-13H2,1-3H3 |
| InChIKey | ZYNIASXRJUJWIV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |