C17H11F3N2O4 — CID 71847357
2-[2-oxo-3-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]propyl]isoindole-1,3-dione (PubChem CID 71847357) has the molecular formula C17H11F3N2O4 and a molecular weight of 364.28 g/mol. Its IUPAC name is 2-[2-oxo-3-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-oxo-3-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71847357 |
| Molecular Formula | C17H11F3N2O4 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[2-oxo-3-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]propyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Cn1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C17H11F3N2O4/c18-17(19,20)10-5-6-14(24)21(7-10)8-11(23)9-22-15(25)12-3-1-2-4-13(12)16(22)26/h1-7H,8-9H2 |
| InChIKey | LUBQXJASSVDALS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|