C21H34N4O2 — CID 71854692
N-tert-butyl-3-[[1-(2-methylpropyl)pyrrolidin-3-yl]methylcarbamoylamino]benzamide (PubChem CID 71854692) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is N-tert-butyl-3-[[1-(2-methylpropyl)pyrrolidin-3-yl]methylcarbamoylamino]benzamide.
| Compound Name | N-tert-butyl-3-[[1-(2-methylpropyl)pyrrolidin-3-yl]methylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 71854692 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | N-tert-butyl-3-[[1-(2-methylpropyl)pyrrolidin-3-yl]methylcarbamoylamino]benzamide |
| SMILES | CC(C)CN1CCC(CNC(=O)Nc2cccc(C(=O)NC(C)(C)C)c2)C1 |
| InChI | InChI=1S/C21H34N4O2/c1-15(2)13-25-10-9-16(14-25)12-22-20(27)23-18-8-6-7-17(11-18)19(26)24-21(3,4)5/h6-8,11,15-16H,9-10,12-14H2,1-5H3,(H,24,26)(H2,22,23,27) |
| InChIKey | BFWRXLDPVPKTSI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |