C21H30FN3O5 — CID 71855047
tert-butyl N-[[1-[[2-(2-fluorophenoxy)propanoylamino]carbamoyl]cyclopentyl]methyl]carbamate (PubChem CID 71855047) has the molecular formula C21H30FN3O5 and a molecular weight of 423.49 g/mol. Its IUPAC name is tert-butyl N-[[1-[[2-(2-fluorophenoxy)propanoylamino]carbamoyl]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[[2-(2-fluorophenoxy)propanoylamino]carbamoyl]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 71855047 |
| Molecular Formula | C21H30FN3O5 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | tert-butyl N-[[1-[[2-(2-fluorophenoxy)propanoylamino]carbamoyl]cyclopentyl]methyl]carbamate |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)C1(CNC(=O)OC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C21H30FN3O5/c1-14(29-16-10-6-5-9-15(16)22)17(26)24-25-18(27)21(11-7-8-12-21)13-23-19(28)30-20(2,3)4/h5-6,9-10,14H,7-8,11-13H2,1-4H3,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | OCKKAIWAUPXTNV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|