C19H18ClFN2O3 — CID 24546269
1-(4-chlorophenyl)-N'-[2-(2-fluorophenoxy)propanoyl]cyclopropane-1-carbohydrazide (PubChem CID 24546269) has the molecular formula C19H18ClFN2O3 and a molecular weight of 376.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N'-[2-(2-fluorophenoxy)propanoyl]cyclopropane-1-carbohydrazide.
| Compound Name | 1-(4-chlorophenyl)-N'-[2-(2-fluorophenoxy)propanoyl]cyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 24546269 |
| Molecular Formula | C19H18ClFN2O3 |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-(4-chlorophenyl)-N'-[2-(2-fluorophenoxy)propanoyl]cyclopropane-1-carbohydrazide |
| SMILES | CC(Oc1ccccc1F)C(=O)NNC(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H18ClFN2O3/c1-12(26-16-5-3-2-4-15(16)21)17(24)22-23-18(25)19(10-11-19)13-6-8-14(20)9-7-13/h2-9,12H,10-11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | LIWJSENAWNPIHM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|