C15H20FNO4 — CID 79037138
2-(2-fluorophenoxy)-N-[(4-hydroxyoxan-4-yl)methyl]propanamide (PubChem CID 79037138) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[(4-hydroxyoxan-4-yl)methyl]propanamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[(4-hydroxyoxan-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 79037138 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[(4-hydroxyoxan-4-yl)methyl]propanamide |
| SMILES | CC(Oc1ccccc1F)C(=O)NCC1(O)CCOCC1 |
| InChI | InChI=1S/C15H20FNO4/c1-11(21-13-5-3-2-4-12(13)16)14(18)17-10-15(19)6-8-20-9-7-15/h2-5,11,19H,6-10H2,1H3,(H,17,18) |
| InChIKey | UEMVPYIMNWFRJG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |