C19H30N2O5 — CID 71857149
3,4-bis(2,6-dimethylmorpholine-4-carbonyl)cyclopentan-1-one (PubChem CID 71857149) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3,4-bis(2,6-dimethylmorpholine-4-carbonyl)cyclopentan-1-one.
| Compound Name | 3,4-bis(2,6-dimethylmorpholine-4-carbonyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 71857149 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 3,4-bis(2,6-dimethylmorpholine-4-carbonyl)cyclopentan-1-one |
| SMILES | CC1CN(C(=O)C2CC(=O)CC2C(=O)N2CC(C)OC(C)C2)CC(C)O1 |
| InChI | InChI=1S/C19H30N2O5/c1-11-7-20(8-12(2)25-11)18(23)16-5-15(22)6-17(16)19(24)21-9-13(3)26-14(4)10-21/h11-14,16-17H,5-10H2,1-4H3 |
| InChIKey | UDVAUNWCGZOSKK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |