C10H13BrN2O4S — CID 71859634
3-bromo-N-piperidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 71859634) has the molecular formula C10H13BrN2O4S and a molecular weight of 337.20 g/mol. Its IUPAC name is 3-bromo-N-piperidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | 3-bromo-N-piperidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 71859634 |
| Molecular Formula | C10H13BrN2O4S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 3-bromo-N-piperidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)N1CCCCC1)c1occc1Br |
| InChI | InChI=1S/C10H13BrN2O4S/c11-8-4-7-17-9(8)10(14)12-18(15,16)13-5-2-1-3-6-13/h4,7H,1-3,5-6H2,(H,12,14) |
| InChIKey | DVZXVNZRPXPYNY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |