C19H25N5O2 — CID 71861211
1-cyclopentyl-1-(oxolan-2-ylmethyl)-3-(1-pyridin-4-ylpyrazol-4-yl)urea (PubChem CID 71861211) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-cyclopentyl-1-(oxolan-2-ylmethyl)-3-(1-pyridin-4-ylpyrazol-4-yl)urea.
| Compound Name | 1-cyclopentyl-1-(oxolan-2-ylmethyl)-3-(1-pyridin-4-ylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 71861211 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-cyclopentyl-1-(oxolan-2-ylmethyl)-3-(1-pyridin-4-ylpyrazol-4-yl)urea |
| SMILES | O=C(Nc1cnn(-c2ccncc2)c1)N(CC1CCCO1)C1CCCC1 |
| InChI | InChI=1S/C19H25N5O2/c25-19(22-15-12-21-24(13-15)17-7-9-20-10-8-17)23(16-4-1-2-5-16)14-18-6-3-11-26-18/h7-10,12-13,16,18H,1-6,11,14H2,(H,22,25) |
| InChIKey | UOXUMFBUBSNUDC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |