C15H16FN3O3 — CID 71864271
methyl 3-fluoro-4-[(1-methylpyrrol-3-yl)methylcarbamoylamino]benzoate (PubChem CID 71864271) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is methyl 3-fluoro-4-[(1-methylpyrrol-3-yl)methylcarbamoylamino]benzoate.
| Compound Name | methyl 3-fluoro-4-[(1-methylpyrrol-3-yl)methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 71864271 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | methyl 3-fluoro-4-[(1-methylpyrrol-3-yl)methylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)NCc2ccn(C)c2)c(F)c1 |
| InChI | InChI=1S/C15H16FN3O3/c1-19-6-5-10(9-19)8-17-15(21)18-13-4-3-11(7-12(13)16)14(20)22-2/h3-7,9H,8H2,1-2H3,(H2,17,18,21) |
| InChIKey | ICTKSWUCGXHHEY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |