C16H14ClN5O5 — CID 71866107
2-[(2-chloro-5-nitrophenyl)methyl-methylamino]-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]acetamide (PubChem CID 71866107) has the molecular formula C16H14ClN5O5 and a molecular weight of 391.77 g/mol. Its IUPAC name is 2-[(2-chloro-5-nitrophenyl)methyl-methylamino]-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]acetamide.
| Compound Name | 2-[(2-chloro-5-nitrophenyl)methyl-methylamino]-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 71866107 |
| Molecular Formula | C16H14ClN5O5 |
| Molecular Weight | 391.77 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[(2-chloro-5-nitrophenyl)methyl-methylamino]-N-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]acetamide |
| SMILES | CN(CC(=O)Nc1nnc(-c2ccco2)o1)Cc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H14ClN5O5/c1-21(8-10-7-11(22(24)25)4-5-12(10)17)9-14(23)18-16-20-19-15(27-16)13-3-2-6-26-13/h2-7H,8-9H2,1H3,(H,18,20,23) |
| InChIKey | ILOKZRUAEKBHJK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 127.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|