C16H21F2NO3S — CID 71874448
N-(cyclopentylmethyl)-2-[4-(difluoromethylsulfonyl)phenyl]-N-methylacetamide (PubChem CID 71874448) has the molecular formula C16H21F2NO3S and a molecular weight of 345.41 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-2-[4-(difluoromethylsulfonyl)phenyl]-N-methylacetamide.
| Compound Name | N-(cyclopentylmethyl)-2-[4-(difluoromethylsulfonyl)phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 71874448 |
| Molecular Formula | C16H21F2NO3S |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-(cyclopentylmethyl)-2-[4-(difluoromethylsulfonyl)phenyl]-N-methylacetamide |
| SMILES | CN(CC1CCCC1)C(=O)Cc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C16H21F2NO3S/c1-19(11-13-4-2-3-5-13)15(20)10-12-6-8-14(9-7-12)23(21,22)16(17)18/h6-9,13,16H,2-5,10-11H2,1H3 |
| InChIKey | OXAXWKPUWOWVBL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |