C14H18ClN3O4 — CID 71875208
3-chloro-1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one (PubChem CID 71875208) has the molecular formula C14H18ClN3O4 and a molecular weight of 327.77 g/mol. Its IUPAC name is 3-chloro-1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one.
| Compound Name | 3-chloro-1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 71875208 |
| Molecular Formula | C14H18ClN3O4 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3-chloro-1-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-5-nitropyridin-2-one |
| SMILES | CC1CCCC(C)N1C(=O)Cn1cc([N+](=O)[O-])cc(Cl)c1=O |
| InChI | InChI=1S/C14H18ClN3O4/c1-9-4-3-5-10(2)17(9)13(19)8-16-7-11(18(21)22)6-12(15)14(16)20/h6-7,9-10H,3-5,8H2,1-2H3 |
| InChIKey | SWSMEWLLVZWESO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 85.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|